CAS 33683-30-6 appears in our catalog under these names: 4-(Quinazolin-4-ylamino)-benzoic acid, 95%, 4-((Quinazolin-4-yl)amino)benzoic acid, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 250mg, 5g, 100mg.
4-(quinazolin-4-ylamino)benzoic acid (CAS 33683-30-6) is a chemical compound with the molecular formula C15H11N3O2 and a molecular weight of 265.27 g/mol. IUPAC name: 4-(quinazolin-4-ylamino)benzoic acid. InChIKey: SGTLIIKTRIMNPW-UHFFFAOYSA-N.
| Molecular formula | C15H11N3O2 |
|---|---|
| Molecular weight | 265.27 g/mol |
| IUPAC name | 4-(quinazolin-4-ylamino)benzoic acid |
| InChIKey | SGTLIIKTRIMNPW-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=NC=N2)NC3=CC=C(C=C3)C(=O)O |
Computed by PubChem (NCBI)