CAS 83665-72-9 is the registry number for 2-(3-(Pyrimidin-5-yl)prop-2-en-1-yl)-2,3-dihydro-1H-isoindole-1,3-dione, 95%. Offered by: AmBeed. Available pack sizes: 1g.
2-[(E)-3-pyrimidin-5-ylprop-2-enyl]isoindole-1,3-dione (CAS 83665-72-9) is a chemical compound with the molecular formula C15H11N3O2 and a molecular weight of 265.27 g/mol. IUPAC name: 2-[(E)-3-pyrimidin-5-ylprop-2-enyl]isoindole-1,3-dione. InChIKey: LGDNSGMZOODCMO-ONEGZZNKSA-N.
| Molecular formula | C15H11N3O2 |
|---|---|
| Molecular weight | 265.27 g/mol |
| IUPAC name | 2-[(E)-3-pyrimidin-5-ylprop-2-enyl]isoindole-1,3-dione |
| InChIKey | LGDNSGMZOODCMO-ONEGZZNKSA-N |
| SMILES | C1=CC=C2C(=C1)C(=O)N(C2=O)C/C=C/C3=CN=CN=C3 |
Computed by PubChem (NCBI)