CAS 55711-62-1 is the registry number for N'-(2-Oxoindolin-3-ylidene)benzohydrazide, 95+%. Offered by: Chemat Brand. Available pack sizes: on request.
N-[(2-hydroxy-1H-indol-3-yl)imino]benzamide (CAS 55711-62-1) is a chemical compound with the molecular formula C15H11N3O2 and a molecular weight of 265.27 g/mol. IUPAC name: N-[(2-hydroxy-1H-indol-3-yl)imino]benzamide. InChIKey: CGIXLJUTDQIFLF-UHFFFAOYSA-N.
| Molecular formula | C15H11N3O2 |
|---|---|
| Molecular weight | 265.27 g/mol |
| IUPAC name | N-[(2-hydroxy-1H-indol-3-yl)imino]benzamide |
| InChIKey | CGIXLJUTDQIFLF-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(=O)N=NC2=C(NC3=CC=CC=C32)O |
Computed by PubChem (NCBI)