Products 1500017-55-9
CAS 1500017-55-9 is the registry number for 4'-Fluoro-2-methoxy-5-nitro-1,1'-biphenyl, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 5g, 10g.
2-(4-fluorophenyl)-1-methoxy-4-nitrobenzene (CAS 1500017-55-9) is a chemical compound with the molecular formula C13H10FNO3 and a molecular weight of 247.22 g/mol. IUPAC name: 2-(4-fluorophenyl)-1-methoxy-4-nitrobenzene. InChIKey: ZAWYRMQNTZTAGY-UHFFFAOYSA-N.
| Molecular formula | C13H10FNO3 |
|---|---|
| Molecular weight | 247.22 g/mol |
| IUPAC name | 2-(4-fluorophenyl)-1-methoxy-4-nitrobenzene |
| InChIKey | ZAWYRMQNTZTAGY-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C=C1)[N+](=O)[O-])C2=CC=C(C=C2)F |
Computed by PubChem (NCBI)