Products 1500224-08-7

CAS 1500224-08-7 appears in our catalog under these names: 4-methoxy-5-methyl-2-(propan-2-yl)benzene-1-sulfonyl chloride, 95%, 2-Isopropyl-4-methoxy-5-methylbenzenesulfonyl chloride, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg.

Structural formula: {0} (CAS {1})

4-methoxy-5-methyl-2-propan-2-ylbenzenesulfonyl chloride (CAS 1500224-08-7) is a chemical compound with the molecular formula C11H15ClO3S and a molecular weight of 262.75 g/mol. IUPAC name: 4-methoxy-5-methyl-2-propan-2-ylbenzenesulfonyl chloride. InChIKey: SXUHXPHKETUHCQ-UHFFFAOYSA-N.

Identity
Molecular formulaC11H15ClO3S
Molecular weight262.75 g/mol
IUPAC name4-methoxy-5-methyl-2-propan-2-ylbenzenesulfonyl chloride
InChIKeySXUHXPHKETUHCQ-UHFFFAOYSA-N
SMILESCC1=CC(=C(C=C1OC)C(C)C)S(=O)(=O)Cl

Computed by PubChem (NCBI)