CAS 88041-83-2 appears in our catalog under these names: 5-tert-Butyl-2-methoxybenzenesulfonyl chloride, 95%, 5-tert-Butyl-2-methoxy-benzenesulfonyl chloride, 5-(tert-Butyl)-2-methoxybenzene-1-sulfonyl chloride, 95+%. Offered by: Combi-blocks, Biosynth, AmBeed. Available pack sizes: 250mg, 5g, 0,5g.
5-tert-butyl-2-methoxybenzenesulfonyl chloride (CAS 88041-83-2) is a chemical compound with the molecular formula C11H15ClO3S and a molecular weight of 262.75 g/mol. IUPAC name: 5-tert-butyl-2-methoxybenzenesulfonyl chloride. InChIKey: MMKJABSTFRSIQT-UHFFFAOYSA-N.
| Molecular formula | C11H15ClO3S |
|---|---|
| Molecular weight | 262.75 g/mol |
| IUPAC name | 5-tert-butyl-2-methoxybenzenesulfonyl chloride |
| InChIKey | MMKJABSTFRSIQT-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=CC(=C(C=C1)OC)S(=O)(=O)Cl |
Computed by PubChem (NCBI)