Products 889939-83-7

CAS 889939-83-7 appears in our catalog under these names: 5-Isopropyl-4-methoxy-2-methyl-benzenesulfonyl chloride, 98%, 5-Isopropyl-4-methoxy-2-methylbenzenesulfonyl chloride, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 1g, 10g, 5g, 100mg.

Structural formula: {0} (CAS {1})

4-methoxy-2-methyl-5-propan-2-ylbenzenesulfonyl chloride (CAS 889939-83-7) is a chemical compound with the molecular formula C11H15ClO3S and a molecular weight of 262.75 g/mol. IUPAC name: 4-methoxy-2-methyl-5-propan-2-ylbenzenesulfonyl chloride. InChIKey: DIDRZYFYDMMUJT-UHFFFAOYSA-N.

Identity
Molecular formulaC11H15ClO3S
Molecular weight262.75 g/mol
IUPAC name4-methoxy-2-methyl-5-propan-2-ylbenzenesulfonyl chloride
InChIKeyDIDRZYFYDMMUJT-UHFFFAOYSA-N
SMILESCC1=CC(=C(C=C1S(=O)(=O)Cl)C(C)C)OC

Computed by PubChem (NCBI)