CAS 69129-42-6 is the registry number for 3-tert-Butyl-4-methoxy-benzenesulfonyl chloride, 97%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 25g, 1g.
3-tert-butyl-4-methoxybenzenesulfonyl chloride (CAS 69129-42-6) is a chemical compound with the molecular formula C11H15ClO3S and a molecular weight of 262.75 g/mol. IUPAC name: 3-tert-butyl-4-methoxybenzenesulfonyl chloride. InChIKey: LJTKLMIMDSOBTG-UHFFFAOYSA-N.
| Molecular formula | C11H15ClO3S |
|---|---|
| Molecular weight | 262.75 g/mol |
| IUPAC name | 3-tert-butyl-4-methoxybenzenesulfonyl chloride |
| InChIKey | LJTKLMIMDSOBTG-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=C(C=CC(=C1)S(=O)(=O)Cl)OC |
Computed by PubChem (NCBI)