Products 58076-33-8

CAS 58076-33-8 is the registry number for 4-(Pentyloxy)benzene-1-sulfonyl chloride, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g.

Structural formula: {0} (CAS {1})

4-pentoxybenzenesulfonyl chloride (CAS 58076-33-8) is a chemical compound with the molecular formula C11H15ClO3S and a molecular weight of 262.75 g/mol. IUPAC name: 4-pentoxybenzenesulfonyl chloride. InChIKey: WPNBAZJJEQNSOH-UHFFFAOYSA-N.

Identity
Molecular formulaC11H15ClO3S
Molecular weight262.75 g/mol
IUPAC name4-pentoxybenzenesulfonyl chloride
InChIKeyWPNBAZJJEQNSOH-UHFFFAOYSA-N
SMILESCCCCCOC1=CC=C(C=C1)S(=O)(=O)Cl

Computed by PubChem (NCBI)