CAS 1500324-40-2 is the registry number for 2,2,2-Trifluoro-1-(3-fluoro-4-hydroxyphenyl)ethanone, ≥95%, ≥95%. Offered by: Chemat. Available pack sizes: 1g.
2,2,2-trifluoro-1-(3-fluoro-4-hydroxyphenyl)ethanone (CAS 1500324-40-2) is a chemical compound with the molecular formula C8H4F4O2 and a molecular weight of 208.11 g/mol. IUPAC name: 2,2,2-trifluoro-1-(3-fluoro-4-hydroxyphenyl)ethanone. InChIKey: MKAKZXHOKCUZMN-UHFFFAOYSA-N.
| Molecular formula | C8H4F4O2 |
|---|---|
| Molecular weight | 208.11 g/mol |
| IUPAC name | 2,2,2-trifluoro-1-(3-fluoro-4-hydroxyphenyl)ethanone |
| InChIKey | MKAKZXHOKCUZMN-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C(=O)C(F)(F)F)F)O |
Computed by PubChem (NCBI)