Products 1501-06-0
CAS 1501-06-0 appears in our catalog under these names: Diethyl 2-acetylglutarate, 98%, Diethyl Alpha-Acetylglutarate, Diethyl a-Acetylglutarate, Diethyl 2-acetylpentanedioate, 95%, Diethyl 2–acetylglutarate. Offered by: Combi-blocks, TRC, AmBeed, GLPBio. Available pack sizes: 1g, 10g, 5g, 25g.
Diethyl 2-acetylpentanedioate (CAS 1501-06-0) is a chemical compound with the molecular formula C11H18O5 and a molecular weight of 230.26 g/mol. IUPAC name: diethyl 2-acetylpentanedioate. InChIKey: NNOGMCQLKMLNPL-UHFFFAOYSA-N.
| Molecular formula | C11H18O5 |
|---|---|
| Molecular weight | 230.26 g/mol |
| IUPAC name | diethyl 2-acetylpentanedioate |
| InChIKey | NNOGMCQLKMLNPL-UHFFFAOYSA-N |
| SMILES | CCOC(=O)CCC(C(=O)C)C(=O)OCC |
Computed by PubChem (NCBI)
Synonyms:
Diethyl 2-acetylglutarate, Pentanedioic acid, 2-acetyl-, diethyl ester, Pentanedioic acid, 2-acetyl-, 1,5-diethyl ester, Diethyl 2-acetylpentanedioate, 1,5-diethyl 2-acetylpentanedioate, Diethyl alpha-acetylglutarate, Diethyl .alpha.-acetoglutarate, Diethyl a-Acetylglutarate, diethyl acetylglutarate, Diethyl alpha-acetoglutarate