Products 212069-31-3
CAS 212069-31-3 appears in our catalog under these names: 1,2:3,4-Di-o-isopropylidene-l-arabinopyranose, 95%, 1,2:3,4-Di-O-isopropylidene-L-arabinopyranose. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 25g, 100g, 5g, 1g, 250g.
(1S,2R,9S)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecane (CAS 212069-31-3) is a chemical compound with the molecular formula C11H18O5 and a molecular weight of 230.26 g/mol. IUPAC name: (1S,2R,9S)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecane. InChIKey: PITVFGWVJISGEN-VTBDLZGYSA-N.
| Molecular formula | C11H18O5 |
|---|---|
| Molecular weight | 230.26 g/mol |
| IUPAC name | (1S,2R,9S)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecane |
| InChIKey | PITVFGWVJISGEN-VTBDLZGYSA-N |
| SMILES | CC1(O[C@H]2COC3[C@@H]([C@H]2O1)OC(O3)(C)C)C |
Computed by PubChem (NCBI)