CAS 40420-22-2 appears in our catalog under these names: Diethyl 3-oxopimelate, 96%, Diethyl 3–Oxopimelate, Diethyl 3-Oxopimelate, Diethyl 3-Oxopimelate, >96.0%(T), Diethyl 3-oxoheptanedioate, 98%, 98%. Offered by: Combi-blocks, GLPBio, Biosynth, TCI, Chemat. Available pack sizes: 5g, 1g, 200mg, 100mg, 250mg, 25g, 100g.
Diethyl 3-oxoheptanedioate (CAS 40420-22-2) is a chemical compound with the molecular formula C11H18O5 and a molecular weight of 230.26 g/mol. IUPAC name: diethyl 3-oxoheptanedioate. InChIKey: RTMQRCLOAACETL-UHFFFAOYSA-N.
| Molecular formula | C11H18O5 |
|---|---|
| Molecular weight | 230.26 g/mol |
| IUPAC name | diethyl 3-oxoheptanedioate |
| InChIKey | RTMQRCLOAACETL-UHFFFAOYSA-N |
| SMILES | CCOC(=O)CCCC(=O)CC(=O)OCC |
Computed by PubChem (NCBI)