CAS 157518-70-2 is the registry number for (R)-2-((S)-2,2-Dimethyl-5-oxo-1,3-dioxolan-4-yl)-4-methylpentanoic acid, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
(2R)-2-[(4S)-2,2-dimethyl-5-oxo-1,3-dioxolan-4-yl]-4-methylpentanoic acid (CAS 157518-70-2) is a chemical compound with the molecular formula C11H18O5 and a molecular weight of 230.26 g/mol. IUPAC name: (2R)-2-[(4S)-2,2-dimethyl-5-oxo-1,3-dioxolan-4-yl]-4-methylpentanoic acid. InChIKey: ZUOVLWXPFQJYLF-SFYZADRCSA-N.
| Molecular formula | C11H18O5 |
|---|---|
| Molecular weight | 230.26 g/mol |
| IUPAC name | (2R)-2-[(4S)-2,2-dimethyl-5-oxo-1,3-dioxolan-4-yl]-4-methylpentanoic acid |
| InChIKey | ZUOVLWXPFQJYLF-SFYZADRCSA-N |
| SMILES | CC(C)C[C@H]([C@H]1C(=O)OC(O1)(C)C)C(=O)O |
Computed by PubChem (NCBI)