CAS 2042339-72-8 is the registry number for tert-Butyl (S)-2-(2,2-dimethyl-5-oxo-1,3-dioxolan-4-yl)acetate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Tert-butyl 2-[(4S)-2,2-dimethyl-5-oxo-1,3-dioxolan-4-yl]acetate (CAS 2042339-72-8) is a chemical compound with the molecular formula C11H18O5 and a molecular weight of 230.26 g/mol. IUPAC name: tert-butyl 2-[(4S)-2,2-dimethyl-5-oxo-1,3-dioxolan-4-yl]acetate. InChIKey: MEHKDRCBPQJMEH-ZETCQYMHSA-N.
| Molecular formula | C11H18O5 |
|---|---|
| Molecular weight | 230.26 g/mol |
| IUPAC name | tert-butyl 2-[(4S)-2,2-dimethyl-5-oxo-1,3-dioxolan-4-yl]acetate |
| InChIKey | MEHKDRCBPQJMEH-ZETCQYMHSA-N |
| SMILES | CC1(O[C@H](C(=O)O1)CC(=O)OC(C)(C)C)C |
Computed by PubChem (NCBI)