Products 1501578-26-2
CAS 1501578-26-2 is the registry number for 2-(Cyclobutanecarboxamidomethyl)thiazole-4-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-[(cyclobutanecarbonylamino)methyl]-1,3-thiazole-4-carboxylic acid (CAS 1501578-26-2) is a chemical compound with the molecular formula C10H12N2O3S and a molecular weight of 240.28 g/mol. IUPAC name: 2-[(cyclobutanecarbonylamino)methyl]-1,3-thiazole-4-carboxylic acid. InChIKey: HERNITUXGMQFFE-UHFFFAOYSA-N.
| Molecular formula | C10H12N2O3S |
|---|---|
| Molecular weight | 240.28 g/mol |
| IUPAC name | 2-[(cyclobutanecarbonylamino)methyl]-1,3-thiazole-4-carboxylic acid |
| InChIKey | HERNITUXGMQFFE-UHFFFAOYSA-N |
| SMILES | C1CC(C1)C(=O)NCC2=NC(=CS2)C(=O)O |
Computed by PubChem (NCBI)