Products 1501904-78-4
CAS 1501904-78-4 appears in our catalog under these names: tert-Butyl 2-fluoronicotinate, 95%, tert-Butyl 2-fluoronicotinate, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 10g.
Tert-butyl 2-fluoropyridine-3-carboxylate (CAS 1501904-78-4) is a chemical compound with the molecular formula C10H12FNO2 and a molecular weight of 197.21 g/mol. IUPAC name: tert-butyl 2-fluoropyridine-3-carboxylate. InChIKey: RREGKIPFSZPJKY-UHFFFAOYSA-N.
| Molecular formula | C10H12FNO2 |
|---|---|
| Molecular weight | 197.21 g/mol |
| IUPAC name | tert-butyl 2-fluoropyridine-3-carboxylate |
| InChIKey | RREGKIPFSZPJKY-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)C1=C(N=CC=C1)F |
Computed by PubChem (NCBI)