CAS 1502732-85-5 appears in our catalog under these names: 2-((1,1,1-Trifluoropropan-2-yl)oxy)pyridine-3-carboxylic acid, 95%, 2-((1,1,1-Trifluoropropan-2-yl)oxy)pyridine-3-carboxylic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 50mg, 0,5g.
2-(1,1,1-trifluoropropan-2-yloxy)pyridine-3-carboxylic acid (CAS 1502732-85-5) is a chemical compound with the molecular formula C9H8F3NO3 and a molecular weight of 235.16 g/mol. IUPAC name: 2-(1,1,1-trifluoropropan-2-yloxy)pyridine-3-carboxylic acid. InChIKey: KHLUBIQGNSAIDB-UHFFFAOYSA-N.
| Molecular formula | C9H8F3NO3 |
|---|---|
| Molecular weight | 235.16 g/mol |
| IUPAC name | 2-(1,1,1-trifluoropropan-2-yloxy)pyridine-3-carboxylic acid |
| InChIKey | KHLUBIQGNSAIDB-UHFFFAOYSA-N |
| SMILES | CC(C(F)(F)F)OC1=C(C=CC=N1)C(=O)O |
Computed by PubChem (NCBI)