Products 1503034-07-8
CAS 1503034-07-8 is the registry number for ((4-Chloropyridin-2-yl)methyl)(methyl)(propan-2-yl)amine. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
N-[(4-chloro-2-pyridinyl)methyl]-N-methylpropan-2-amine (CAS 1503034-07-8) is a chemical compound with the molecular formula C10H15ClN2 and a molecular weight of 198.69 g/mol. IUPAC name: N-[(4-chloro-2-pyridinyl)methyl]-N-methylpropan-2-amine. InChIKey: MBOIUJRHHRJIRQ-UHFFFAOYSA-N.
| Molecular formula | C10H15ClN2 |
|---|---|
| Molecular weight | 198.69 g/mol |
| IUPAC name | N-[(4-chloro-2-pyridinyl)methyl]-N-methylpropan-2-amine |
| InChIKey | MBOIUJRHHRJIRQ-UHFFFAOYSA-N |
| SMILES | CC(C)N(C)CC1=NC=CC(=C1)Cl |
Computed by PubChem (NCBI)