Products 1503144-26-0

CAS 1503144-26-0 is the registry number for 8-Fluoro-1-methyl-1,2,3,4-tetrahydroquinoline-4-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

8-fluoro-1-methyl-3,4-dihydro-2H-quinoline-4-carboxylic acid (CAS 1503144-26-0) is a chemical compound with the molecular formula C11H12FNO2 and a molecular weight of 209.22 g/mol. IUPAC name: 8-fluoro-1-methyl-3,4-dihydro-2H-quinoline-4-carboxylic acid. InChIKey: GEBHHYVZLMOLKH-UHFFFAOYSA-N.

Identity
Molecular formulaC11H12FNO2
Molecular weight209.22 g/mol
IUPAC name8-fluoro-1-methyl-3,4-dihydro-2H-quinoline-4-carboxylic acid
InChIKeyGEBHHYVZLMOLKH-UHFFFAOYSA-N
SMILESCN1CCC(C2=C1C(=CC=C2)F)C(=O)O

Computed by PubChem (NCBI)