CAS 911457-76-6 is the registry number for O-Phenyl-D-tyrosine hydrochloride, 97%. Offered by: AmBeed. Available pack sizes: 1g.
(2R)-2-amino-3-(4-phenoxyphenyl)propanoic acid;hydrochloride (CAS 911457-76-6) is a chemical compound with the molecular formula C15H16ClNO3 and a molecular weight of 293.74 g/mol. IUPAC name: (2R)-2-amino-3-(4-phenoxyphenyl)propanoic acid;hydrochloride. InChIKey: JTNCAXKXGJBTRG-PFEQFJNWSA-N.
| Molecular formula | C15H16ClNO3 |
|---|---|
| Molecular weight | 293.74 g/mol |
| IUPAC name | (2R)-2-amino-3-(4-phenoxyphenyl)propanoic acid;hydrochloride |
| InChIKey | JTNCAXKXGJBTRG-PFEQFJNWSA-N |
| SMILES | C1=CC=C(C=C1)OC2=CC=C(C=C2)C[C@H](C(=O)O)N.Cl |
Computed by PubChem (NCBI)