Products 1505149-43-8
CAS 1505149-43-8 is the registry number for 2-(4-(Dimethylcarbamoyl)-1H-1,2,3-triazol-1-yl)acetic acid. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
2-[4-(dimethylcarbamoyl)triazol-1-yl]acetic acid (CAS 1505149-43-8) is a chemical compound with the molecular formula C7H10N4O3 and a molecular weight of 198.18 g/mol. IUPAC name: 2-[4-(dimethylcarbamoyl)triazol-1-yl]acetic acid. InChIKey: GYVREGHQUXPYLN-UHFFFAOYSA-N.
| Molecular formula | C7H10N4O3 |
|---|---|
| Molecular weight | 198.18 g/mol |
| IUPAC name | 2-[4-(dimethylcarbamoyl)triazol-1-yl]acetic acid |
| InChIKey | GYVREGHQUXPYLN-UHFFFAOYSA-N |
| SMILES | CN(C)C(=O)C1=CN(N=N1)CC(=O)O |
Computed by PubChem (NCBI)