CAS 150543-37-6 appears in our catalog under these names: 5-((Benzyloxy)carbonyl)-5-azaspiro[2.4]heptane-1-carboxylic acid, 95%, 5-((Benzyloxy)carbonyl)-5-azaspiro(2.4)heptane-1-carboxylic acid, 98+%, 5-((benzyloxy)carbonyl)-5-azaspiro(2.4)heptane-1-carboxylic acid, 5-Azaspiro[2.4]heptane-1,5-dicarboxylic acid, 5-(phenylmethyl) ester, 96%, 96%. Offered by: Combi-blocks, AmBeed, Biosynth, Chemat. Available pack sizes: 1g, 250mg, 10g, 2,5g, 100mg, 500mg.
5-phenylmethoxycarbonyl-5-azaspiro[2.4]heptane-2-carboxylic acid (CAS 150543-37-6) is a chemical compound with the molecular formula C15H17NO4 and a molecular weight of 275.30 g/mol. IUPAC name: 5-phenylmethoxycarbonyl-5-azaspiro[2.4]heptane-2-carboxylic acid. InChIKey: ATCSVGGHJWQTPC-UHFFFAOYSA-N.
| Molecular formula | C15H17NO4 |
|---|---|
| Molecular weight | 275.30 g/mol |
| IUPAC name | 5-phenylmethoxycarbonyl-5-azaspiro[2.4]heptane-2-carboxylic acid |
| InChIKey | ATCSVGGHJWQTPC-UHFFFAOYSA-N |
| SMILES | C1CN(CC12CC2C(=O)O)C(=O)OCC3=CC=CC=C3 |
Computed by PubChem (NCBI)