CAS 1506287-43-9 appears in our catalog under these names: (1-Phenylcyclopropyl)methanesulfonyl chloride, 95%, (1-Phenylcyclopropyl)methanesulfonyl chloride. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
(1-phenylcyclopropyl)methanesulfonyl chloride (CAS 1506287-43-9) is a chemical compound with the molecular formula C10H11ClO2S and a molecular weight of 230.71 g/mol. IUPAC name: (1-phenylcyclopropyl)methanesulfonyl chloride. InChIKey: MBEUDQLNJWAYSO-UHFFFAOYSA-N.
| Molecular formula | C10H11ClO2S |
|---|---|
| Molecular weight | 230.71 g/mol |
| IUPAC name | (1-phenylcyclopropyl)methanesulfonyl chloride |
| InChIKey | MBEUDQLNJWAYSO-UHFFFAOYSA-N |
| SMILES | C1CC1(CS(=O)(=O)Cl)C2=CC=CC=C2 |
Computed by PubChem (NCBI)