CAS 348080-86-4 is the registry number for (2,3-Dihydro-1H-inden-2-yl)methanesulfonyl chloride, 95%. Offered by: AmBeed. Available pack sizes: 1g.
2,3-dihydro-1H-inden-2-ylmethanesulfonyl chloride (CAS 348080-86-4) is a chemical compound with the molecular formula C10H11ClO2S and a molecular weight of 230.71 g/mol. IUPAC name: 2,3-dihydro-1H-inden-2-ylmethanesulfonyl chloride. InChIKey: DDZMCVFQOSFEAN-UHFFFAOYSA-N.
| Molecular formula | C10H11ClO2S |
|---|---|
| Molecular weight | 230.71 g/mol |
| IUPAC name | 2,3-dihydro-1H-inden-2-ylmethanesulfonyl chloride |
| InChIKey | DDZMCVFQOSFEAN-UHFFFAOYSA-N |
| SMILES | C1C(CC2=CC=CC=C21)CS(=O)(=O)Cl |
Computed by PubChem (NCBI)