CAS 61551-49-3 appears in our catalog under these names: 5,6,7,8–Tetrahydronaphthalene–2–sulfonyl chloride, 5,6,7,8-Tetrahydronaphthalene-2-sulfonyl chloride 98%, 5,6,7,8-Tetrahydronaphthalene-2-sulfonyl chloride, 97%. Offered by: GLPBio, Ambeed, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 5g, 500mg, 2.5g, 10g.
5,6,7,8-tetrahydronaphthalene-2-sulfonyl chloride (CAS 61551-49-3) is a chemical compound with the molecular formula C10H11ClO2S and a molecular weight of 230.71 g/mol. IUPAC name: 5,6,7,8-tetrahydronaphthalene-2-sulfonyl chloride. InChIKey: FNEIMPFRVQQOMV-UHFFFAOYSA-N.
| Molecular formula | C10H11ClO2S |
|---|---|
| Molecular weight | 230.71 g/mol |
| IUPAC name | 5,6,7,8-tetrahydronaphthalene-2-sulfonyl chloride |
| InChIKey | FNEIMPFRVQQOMV-UHFFFAOYSA-N |
| SMILES | C1CCC2=C(C1)C=CC(=C2)S(=O)(=O)Cl |
Computed by PubChem (NCBI)