Products 7031-26-7

CAS 7031-26-7 is the registry number for 3-[(4-Chlorobenzyl)thio]propanoic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

3-[(4-chlorophenyl)methylsulfanyl]propanoic acid (CAS 7031-26-7) is a chemical compound with the molecular formula C10H11ClO2S and a molecular weight of 230.71 g/mol. IUPAC name: 3-[(4-chlorophenyl)methylsulfanyl]propanoic acid. InChIKey: AJQDHOFKHIZLBA-UHFFFAOYSA-N.

Identity
Molecular formulaC10H11ClO2S
Molecular weight230.71 g/mol
IUPAC name3-[(4-chlorophenyl)methylsulfanyl]propanoic acid
InChIKeyAJQDHOFKHIZLBA-UHFFFAOYSA-N
SMILESC1=CC(=CC=C1CSCCC(=O)O)Cl

Computed by PubChem (NCBI)