Products 1803586-17-5
CAS 1803586-17-5 appears in our catalog under these names: 1-{((3-chloro-4-methoxyphenyl)methyl)sulfanyl}ethan-1-one, 95%, 1-{((3-Chloro-4-methoxyphenyl)methyl)sulfanyl}ethan-1-one. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 2,5g, 250mg.
S-[(3-chloro-4-methoxyphenyl)methyl] ethanethioate (CAS 1803586-17-5) is a chemical compound with the molecular formula C10H11ClO2S and a molecular weight of 230.71 g/mol. IUPAC name: S-[(3-chloro-4-methoxyphenyl)methyl] ethanethioate. InChIKey: ZKYOXIKNPIYWMA-UHFFFAOYSA-N.
| Molecular formula | C10H11ClO2S |
|---|---|
| Molecular weight | 230.71 g/mol |
| IUPAC name | S-[(3-chloro-4-methoxyphenyl)methyl] ethanethioate |
| InChIKey | ZKYOXIKNPIYWMA-UHFFFAOYSA-N |
| SMILES | CC(=O)SCC1=CC(=C(C=C1)OC)Cl |
Computed by PubChem (NCBI)