Products 1507137-28-1
CAS 1507137-28-1 is the registry number for Ethyl 2-(5-(dimethylamino)-3H-imidazo(4,5-b)pyridin-2-yl)acetate. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
Ethyl 2-[5-(dimethylamino)-1H-imidazo[4,5-b]pyridin-2-yl]acetate (CAS 1507137-28-1) is a chemical compound with the molecular formula C12H16N4O2 and a molecular weight of 248.28 g/mol. IUPAC name: ethyl 2-[5-(dimethylamino)-1H-imidazo[4,5-b]pyridin-2-yl]acetate. InChIKey: WRIFYPOJQJLFNU-UHFFFAOYSA-N.
| Molecular formula | C12H16N4O2 |
|---|---|
| Molecular weight | 248.28 g/mol |
| IUPAC name | ethyl 2-[5-(dimethylamino)-1H-imidazo[4,5-b]pyridin-2-yl]acetate |
| InChIKey | WRIFYPOJQJLFNU-UHFFFAOYSA-N |
| SMILES | CCOC(=O)CC1=NC2=C(N1)C=CC(=N2)N(C)C |
Computed by PubChem (NCBI)