CAS 1507308-67-9 appears in our catalog under these names: Minodronic Acid Impurity 13, Minodronic Acid Impurity 31. Offered by: Chemat Brand, Hubei YoungXin. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg.
2-(2-chloroimidazo[1,2-a]pyridin-3-yl)acetic acid (CAS 1507308-67-9) is a chemical compound with the molecular formula C9H7ClN2O2 and a molecular weight of 210.62 g/mol. IUPAC name: 2-(2-chloroimidazo[1,2-a]pyridin-3-yl)acetic acid. InChIKey: DWRQPUMFLMISQC-UHFFFAOYSA-N.
| Molecular formula | C9H7ClN2O2 |
|---|---|
| Molecular weight | 210.62 g/mol |
| IUPAC name | 2-(2-chloroimidazo[1,2-a]pyridin-3-yl)acetic acid |
| InChIKey | DWRQPUMFLMISQC-UHFFFAOYSA-N |
| SMILES | C1=CC2=NC(=C(N2C=C1)CC(=O)O)Cl |
Computed by PubChem (NCBI)