CAS 150805-89-3 appears in our catalog under these names: 5-Chloro-7-nitro-2,3-dihydro-1-benzofuran, 95%, 5-Chloro-7-nitro-2,3-dihydro-1-benzofuran. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 250mg, 2,5g.
5-chloro-7-nitro-2,3-dihydro-1-benzofuran (CAS 150805-89-3) is a chemical compound with the molecular formula C8H6ClNO3 and a molecular weight of 199.59 g/mol. IUPAC name: 5-chloro-7-nitro-2,3-dihydro-1-benzofuran. InChIKey: DUNYELSULQJEHT-UHFFFAOYSA-N.
| Molecular formula | C8H6ClNO3 |
|---|---|
| Molecular weight | 199.59 g/mol |
| IUPAC name | 5-chloro-7-nitro-2,3-dihydro-1-benzofuran |
| InChIKey | DUNYELSULQJEHT-UHFFFAOYSA-N |
| SMILES | C1COC2=C1C=C(C=C2[N+](=O)[O-])Cl |
Computed by PubChem (NCBI)