CAS 150812-21-8 appears in our catalog under these names: N1-(4-Fluorobenzyl)-3-nitro-1,4-phenylenediamine, >97.0%(HPLC)(T), N1-(4-Fluorobenzyl)-3-nitrobenzene-1,4-diamine 97%, 1-N-[(4-Fluorophenyl)methyl]-3-nitrobenzene-1,4-diamine, 97%, 97%, 1-N-[(4-Fluorophenyl)methyl]-3-nitrobenzene-1,4-diamine, 97%. Offered by: TCI, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 250mg.
4-N-[(4-fluorophenyl)methyl]-2-nitrobenzene-1,4-diamine (CAS 150812-21-8) is a chemical compound with the molecular formula C13H12FN3O2 and a molecular weight of 261.25 g/mol. IUPAC name: 4-N-[(4-fluorophenyl)methyl]-2-nitrobenzene-1,4-diamine. InChIKey: XTDZJOIEYRRRGJ-UHFFFAOYSA-N.
| Molecular formula | C13H12FN3O2 |
|---|---|
| Molecular weight | 261.25 g/mol |
| IUPAC name | 4-N-[(4-fluorophenyl)methyl]-2-nitrobenzene-1,4-diamine |
| InChIKey | XTDZJOIEYRRRGJ-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1CNC2=CC(=C(C=C2)N)[N+](=O)[O-])F |
Computed by PubChem (NCBI)