Products 150975-95-4

CAS 150975-95-4 is the registry number for 5-(Methylsulfonamido)-1H-indole-2-carboxylic acid, 97%. Offered by: Chemat Brand. Available pack sizes: on request.

5-(methanesulfonamido)-1H-indole-2-carboxylic acid (CAS 150975-95-4) is a chemical compound with the molecular formula C10H10N2O4S and a molecular weight of 254.26 g/mol. IUPAC name: 5-(methanesulfonamido)-1H-indole-2-carboxylic acid. InChIKey: AHXMYKDPQPQFMW-UHFFFAOYSA-N.

Identity
Molecular formulaC10H10N2O4S
Molecular weight254.26 g/mol
IUPAC name5-(methanesulfonamido)-1H-indole-2-carboxylic acid
InChIKeyAHXMYKDPQPQFMW-UHFFFAOYSA-N
SMILESCS(=O)(=O)NC1=CC2=C(C=C1)NC(=C2)C(=O)O

Computed by PubChem (NCBI)