Products 702664-43-5

CAS 702664-43-5 is the registry number for 4-(2,4-Dioxo-1,4-dihydrothieno[3,2-d]pyrimidin-3(2h)-yl)butanoic acid, 90%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.

Structural formula: {0} (CAS {1})

4-(2,4-dioxo-1H-thieno[3,2-d]pyrimidin-3-yl)butanoic acid (CAS 702664-43-5) is a chemical compound with the molecular formula C10H10N2O4S and a molecular weight of 254.26 g/mol. IUPAC name: 4-(2,4-dioxo-1H-thieno[3,2-d]pyrimidin-3-yl)butanoic acid. InChIKey: WKIQTWKLNMZWBQ-UHFFFAOYSA-N.

Identity
Molecular formulaC10H10N2O4S
Molecular weight254.26 g/mol
IUPAC name4-(2,4-dioxo-1H-thieno[3,2-d]pyrimidin-3-yl)butanoic acid
InChIKeyWKIQTWKLNMZWBQ-UHFFFAOYSA-N
SMILESC1=CSC2=C1NC(=O)N(C2=O)CCCC(=O)O

Computed by PubChem (NCBI)