CAS 854357-50-9 appears in our catalog under these names: [(1,1-Dioxido-1,2-benzisothiazol-3-yl)(methyl)amino]acetic acid, 95%, 2-((1,1-Dioxo-1,2-benzothiazol-3-yl)(methyl)amino)acetic acid, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 10g, 250mg, 1g, 100mg.
2-[(1,1-dioxo-1,2-benzothiazol-3-yl)-methylamino]acetic acid (CAS 854357-50-9) is a chemical compound with the molecular formula C10H10N2O4S and a molecular weight of 254.26 g/mol. IUPAC name: 2-[(1,1-dioxo-1,2-benzothiazol-3-yl)-methylamino]acetic acid. InChIKey: WYAVGKBCFWUKSR-UHFFFAOYSA-N.
| Molecular formula | C10H10N2O4S |
|---|---|
| Molecular weight | 254.26 g/mol |
| IUPAC name | 2-[(1,1-dioxo-1,2-benzothiazol-3-yl)-methylamino]acetic acid |
| InChIKey | WYAVGKBCFWUKSR-UHFFFAOYSA-N |
| SMILES | CN(CC(=O)O)C1=NS(=O)(=O)C2=CC=CC=C21 |
Computed by PubChem (NCBI)