CAS 24683-25-8 appears in our catalog under these names: Piroxicam EP Impurity C, Despyridyl Piroxicam (Piroxicam Impurity C), 4-Hydroxy-2-methyl-2H-1,2-benzothiazine-3-carboxamide 1,1-Dioxide. Offered by: Chemat Brand, TRC, Mikromol, Biosynth. Available pack sizes: on request, 50mg, 5mg, 4x25mg, 25mg, 100mg, 10mg.
4-hydroxy-2-methyl-1,1-dioxo-1lambda6,2-benzothiazine-3-carboxamide (CAS 24683-25-8) is a chemical compound with the molecular formula C10H10N2O4S and a molecular weight of 254.26 g/mol. IUPAC name: 4-hydroxy-2-methyl-1,1-dioxo-1lambda6,2-benzothiazine-3-carboxamide. InChIKey: BBOFTHBIXOWDMA-UHFFFAOYSA-N.
| Molecular formula | C10H10N2O4S |
|---|---|
| Molecular weight | 254.26 g/mol |
| IUPAC name | 4-hydroxy-2-methyl-1,1-dioxo-1lambda6,2-benzothiazine-3-carboxamide |
| InChIKey | BBOFTHBIXOWDMA-UHFFFAOYSA-N |
| SMILES | CN1C(=C(C2=CC=CC=C2S1(=O)=O)O)C(=O)N |
Computed by PubChem (NCBI)