CAS 743440-15-5 appears in our catalog under these names: 3-[(1,1-Dioxido-1,2-benzisothiazol-3-yl)amino]propanoic acid, 95%, 3-((1,1-Dioxo-1,2-benzothiazol-3-yl)amino)propanoic acid, 95%, 3-((1,1-Dioxo-1,2-benzothiazol-3-yl)amino)propanoic acid. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 5g, 10g, 250mg, 1g, 100mg, 0,5g.
3-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]propanoic acid (CAS 743440-15-5) is a chemical compound with the molecular formula C10H10N2O4S and a molecular weight of 254.26 g/mol. IUPAC name: 3-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]propanoic acid. InChIKey: YFWGDLVXIBQIFI-UHFFFAOYSA-N.
| Molecular formula | C10H10N2O4S |
|---|---|
| Molecular weight | 254.26 g/mol |
| IUPAC name | 3-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]propanoic acid |
| InChIKey | YFWGDLVXIBQIFI-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=NCCC(=O)O)NS2(=O)=O |
Computed by PubChem (NCBI)