Products 1509787-34-1
CAS 1509787-34-1 is the registry number for {6-Chloro-8-methylimidazo(1,2-a)pyridin-2-yl}methanamine. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
(6-chloro-8-methylimidazo[1,2-a]pyridin-2-yl)methanamine (CAS 1509787-34-1) is a chemical compound with the molecular formula C9H10ClN3 and a molecular weight of 195.65 g/mol. IUPAC name: (6-chloro-8-methylimidazo[1,2-a]pyridin-2-yl)methanamine. InChIKey: RRYMCBKBTQNYEJ-UHFFFAOYSA-N.
| Molecular formula | C9H10ClN3 |
|---|---|
| Molecular weight | 195.65 g/mol |
| IUPAC name | (6-chloro-8-methylimidazo[1,2-a]pyridin-2-yl)methanamine |
| InChIKey | RRYMCBKBTQNYEJ-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CN2C1=NC(=C2)CN)Cl |
Computed by PubChem (NCBI)