CAS 151-06-4 appears in our catalog under these names: Chlorphentermine Hydrochloride (1mg/ml in Acetonitrile), Chlorphentermine Hydrochloride. Offered by: TRC, LoGiCal. Available pack sizes: 10x1ml, 500mg, 50mg, 10mg.
1-(4-chlorophenyl)-2-methylpropan-2-amine;hydrochloride (CAS 151-06-4) is a chemical compound with the molecular formula C10H15Cl2N and a molecular weight of 220.14 g/mol. IUPAC name: 1-(4-chlorophenyl)-2-methylpropan-2-amine;hydrochloride. InChIKey: WEJDYJKJPUPMLH-UHFFFAOYSA-N.
| Molecular formula | C10H15Cl2N |
|---|---|
| Molecular weight | 220.14 g/mol |
| IUPAC name | 1-(4-chlorophenyl)-2-methylpropan-2-amine;hydrochloride |
| InChIKey | WEJDYJKJPUPMLH-UHFFFAOYSA-N |
| SMILES | CC(C)(CC1=CC=C(C=C1)Cl)N.Cl |
Computed by PubChem (NCBI)