CAS 1510918-76-9 is the registry number for 4-(Benzyloxy)thiophene-2-carboxylic acid. Offered by: Biosynth. Available pack sizes: 100mg, 50mg, 250mg, 1000mg, 500mg.
4-phenylmethoxythiophene-2-carboxylic acid (CAS 1510918-76-9) is a chemical compound with the molecular formula C12H10O3S and a molecular weight of 234.27 g/mol. IUPAC name: 4-phenylmethoxythiophene-2-carboxylic acid. InChIKey: QWDOZQBTWSVZGX-UHFFFAOYSA-N.
| Molecular formula | C12H10O3S |
|---|---|
| Molecular weight | 234.27 g/mol |
| IUPAC name | 4-phenylmethoxythiophene-2-carboxylic acid |
| InChIKey | QWDOZQBTWSVZGX-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC2=CSC(=C2)C(=O)O |
Computed by PubChem (NCBI)