CAS 15110-74-4 appears in our catalog under these names: 2,5-Dinitrofluorene, 95%, 2,5-Dinitrofluorene. Offered by: Combi-blocks, Biosynth. Available pack sizes: 1g, 10g, 5g, 2g.
2,5-dinitro-9H-fluorene (CAS 15110-74-4) is a chemical compound with the molecular formula C13H8N2O4 and a molecular weight of 256.21 g/mol. IUPAC name: 2,5-dinitro-9H-fluorene. InChIKey: XHAHNUAISBGLEX-UHFFFAOYSA-N.
| Molecular formula | C13H8N2O4 |
|---|---|
| Molecular weight | 256.21 g/mol |
| IUPAC name | 2,5-dinitro-9H-fluorene |
| InChIKey | XHAHNUAISBGLEX-UHFFFAOYSA-N |
| SMILES | C1C2=C(C3=C1C=C(C=C3)[N+](=O)[O-])C(=CC=C2)[N+](=O)[O-] |
Computed by PubChem (NCBI)