CAS 5405-53-8 appears in our catalog under these names: 2,7-Dinitrofluorene, 2,7-Dinitrofluorene, >97.0%(HPLC)(N), 2,7-DINITROFLUORENE, 97%, 2,7-Dinitrofluorene, min. 95 %, 10 g, 2,7-Dinitrofluorene, min. 95 %, 25 g. Offered by: TRC, Biosynth, TCI, Sigma-Aldrich, Roth. Available pack sizes: 10g, 1g, 5g, 50g, 25g.
2,7-dinitro-9H-fluorene (CAS 5405-53-8) is a chemical compound with the molecular formula C13H8N2O4 and a molecular weight of 256.21 g/mol. IUPAC name: 2,7-dinitro-9H-fluorene. InChIKey: IHZCVUBSTYOFSJ-UHFFFAOYSA-N.
| Molecular formula | C13H8N2O4 |
|---|---|
| Molecular weight | 256.21 g/mol |
| IUPAC name | 2,7-dinitro-9H-fluorene |
| InChIKey | IHZCVUBSTYOFSJ-UHFFFAOYSA-N |
| SMILES | C1C2=C(C=CC(=C2)[N+](=O)[O-])C3=C1C=C(C=C3)[N+](=O)[O-] |
Computed by PubChem (NCBI)