CAS 16398-16-6 is the registry number for 2-Nitrodibenzo[b,f][1,4]oxazepin-11(10h)-one, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g, 250mg.
8-nitro-5H-benzo[b][1,4]benzoxazepin-6-one (CAS 16398-16-6) is a chemical compound with the molecular formula C13H8N2O4 and a molecular weight of 256.21 g/mol. IUPAC name: 8-nitro-5H-benzo[b][1,4]benzoxazepin-6-one. InChIKey: AKXKFNUVGGYMJP-UHFFFAOYSA-N.
| Molecular formula | C13H8N2O4 |
|---|---|
| Molecular weight | 256.21 g/mol |
| IUPAC name | 8-nitro-5H-benzo[b][1,4]benzoxazepin-6-one |
| InChIKey | AKXKFNUVGGYMJP-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)NC(=O)C3=C(O2)C=CC(=C3)[N+](=O)[O-] |
Computed by PubChem (NCBI)