Products 664303-07-5
CAS 664303-07-5 is the registry number for N-(3-Ethynylphenyl)-5-nitrofuran-2-carboxamide, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
N-(3-ethynylphenyl)-5-nitrofuran-2-carboxamide (CAS 664303-07-5) is a chemical compound with the molecular formula C13H8N2O4 and a molecular weight of 256.21 g/mol. IUPAC name: N-(3-ethynylphenyl)-5-nitrofuran-2-carboxamide. InChIKey: OYTGIQNWDDYRHS-UHFFFAOYSA-N.
| Molecular formula | C13H8N2O4 |
|---|---|
| Molecular weight | 256.21 g/mol |
| IUPAC name | N-(3-ethynylphenyl)-5-nitrofuran-2-carboxamide |
| InChIKey | OYTGIQNWDDYRHS-UHFFFAOYSA-N |
| SMILES | C#CC1=CC(=CC=C1)NC(=O)C2=CC=C(O2)[N+](=O)[O-] |
Computed by PubChem (NCBI)