CAS 2248289-32-7 is the registry number for 1,3-Dioxoisoindolin-2-yl 1-cyanocyclopropane-1-carboxylate, 95%. Offered by: AmBeed. Available pack sizes: 1g, 5g.
(1,3-dioxoisoindol-2-yl) 1-cyanocyclopropane-1-carboxylate (CAS 2248289-32-7) is a chemical compound with the molecular formula C13H8N2O4 and a molecular weight of 256.21 g/mol. IUPAC name: (1,3-dioxoisoindol-2-yl) 1-cyanocyclopropane-1-carboxylate. InChIKey: ZHLQEQRQKJCQDN-UHFFFAOYSA-N.
| Molecular formula | C13H8N2O4 |
|---|---|
| Molecular weight | 256.21 g/mol |
| IUPAC name | (1,3-dioxoisoindol-2-yl) 1-cyanocyclopropane-1-carboxylate |
| InChIKey | ZHLQEQRQKJCQDN-UHFFFAOYSA-N |
| SMILES | C1CC1(C#N)C(=O)ON2C(=O)C3=CC=CC=C3C2=O |
Computed by PubChem (NCBI)