Products 151124-32-2
CAS 151124-32-2 is the registry number for Leucettamol A. Offered by: MedChemExpress. Available pack sizes: Get quote.
4,5-bis(1,3-benzodioxol-5-ylmethyl)-1-methylimidazol-2-amine (CAS 151124-32-2) is a chemical compound with the molecular formula C20H19N3O4 and a molecular weight of 365.4 g/mol. IUPAC name: 4,5-bis(1,3-benzodioxol-5-ylmethyl)-1-methylimidazol-2-amine. InChIKey: CHUHMZZQHYOKBF-UHFFFAOYSA-N.
| Molecular formula | C20H19N3O4 |
|---|---|
| Molecular weight | 365.4 g/mol |
| IUPAC name | 4,5-bis(1,3-benzodioxol-5-ylmethyl)-1-methylimidazol-2-amine |
| InChIKey | CHUHMZZQHYOKBF-UHFFFAOYSA-N |
| SMILES | CN1C(=C(N=C1N)CC2=CC3=C(C=C2)OCO3)CC4=CC5=C(C=C4)OCO5 |
Computed by PubChem (NCBI)