CAS 898257-48-2 is the registry number for (2-Hydroxynaphthalen-1-yl)boronic acid, 95%, 95%. Offered by: Chemat. Available pack sizes: 250mg.
(2-hydroxynaphthalen-1-yl)boronic acid (CAS 898257-48-2) is a chemical compound with the molecular formula C10H9BO3 and a molecular weight of 187.99 g/mol. IUPAC name: (2-hydroxynaphthalen-1-yl)boronic acid. InChIKey: GDVCCKPVARLVLL-UHFFFAOYSA-N.
| Molecular formula | C10H9BO3 |
|---|---|
| Molecular weight | 187.99 g/mol |
| IUPAC name | (2-hydroxynaphthalen-1-yl)boronic acid |
| InChIKey | GDVCCKPVARLVLL-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=CC2=CC=CC=C12)O)(O)O |
Computed by PubChem (NCBI)