Products 15118-48-6
CAS 15118-48-6 is the registry number for 4-(4-Methoxyphenyl)-2,2-dimethyl-4-oxobutanoic acid. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
4-(4-methoxyphenyl)-2,2-dimethyl-4-oxobutanoic acid (CAS 15118-48-6) is a chemical compound with the molecular formula C13H16O4 and a molecular weight of 236.26 g/mol. IUPAC name: 4-(4-methoxyphenyl)-2,2-dimethyl-4-oxobutanoic acid. InChIKey: MWWLDHHCRLWJJE-UHFFFAOYSA-N.
| Molecular formula | C13H16O4 |
|---|---|
| Molecular weight | 236.26 g/mol |
| IUPAC name | 4-(4-methoxyphenyl)-2,2-dimethyl-4-oxobutanoic acid |
| InChIKey | MWWLDHHCRLWJJE-UHFFFAOYSA-N |
| SMILES | CC(C)(CC(=O)C1=CC=C(C=C1)OC)C(=O)O |
Computed by PubChem (NCBI)