CAS 1512021-69-0 is the registry number for 2-Ethyl-6-(trifluoromethyl)-2H-benzo[b][1,4]oxazin-3(4H)-one, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-ethyl-6-(trifluoromethyl)-4H-1,4-benzoxazin-3-one (CAS 1512021-69-0) is a chemical compound with the molecular formula C11H10F3NO2 and a molecular weight of 245.20 g/mol. IUPAC name: 2-ethyl-6-(trifluoromethyl)-4H-1,4-benzoxazin-3-one. InChIKey: LSYMKTMCNQSCFV-UHFFFAOYSA-N.
| Molecular formula | C11H10F3NO2 |
|---|---|
| Molecular weight | 245.20 g/mol |
| IUPAC name | 2-ethyl-6-(trifluoromethyl)-4H-1,4-benzoxazin-3-one |
| InChIKey | LSYMKTMCNQSCFV-UHFFFAOYSA-N |
| SMILES | CCC1C(=O)NC2=C(O1)C=CC(=C2)C(F)(F)F |
Computed by PubChem (NCBI)