CAS 7125-73-7 appears in our catalog under these names: 6-(4-(Trifluoromethyl)phenyl)morpholin-3-one, 97%, 6-(4-(Trifluoromethyl)phenyl)morpholin-3-one. Offered by: Chemat Brand, TRC. Available pack sizes: on request, 250mg.
6-[4-(trifluoromethyl)phenyl]morpholin-3-one (CAS 7125-73-7) is a chemical compound with the molecular formula C11H10F3NO2 and a molecular weight of 245.20 g/mol. IUPAC name: 6-[4-(trifluoromethyl)phenyl]morpholin-3-one. InChIKey: UODXSCCNACAPCE-UHFFFAOYSA-N.
| Molecular formula | C11H10F3NO2 |
|---|---|
| Molecular weight | 245.20 g/mol |
| IUPAC name | 6-[4-(trifluoromethyl)phenyl]morpholin-3-one |
| InChIKey | UODXSCCNACAPCE-UHFFFAOYSA-N |
| SMILES | C1C(OCC(=O)N1)C2=CC=C(C=C2)C(F)(F)F |
Computed by PubChem (NCBI)